| Name |
Vitexin 2''-O-rhamnoside |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
64820-99-1 |
| C_ID |
C00006217
, 
|
| InChIKey |
LYGPBZVKGHHTIE-LMPZBPKWNA-N |
| InChICode |
InChI=1S/C27H30O14/c1-9-19(33)21(35)23(37)27(38-9)41-26-22(36)20(34)16(8-28)40-25(26)18-13(31)6-12(30)17-14(32)7-15(39-24(17)18)10-2-4-11(29)5-3-10/h2-7,9,16,19-23,25-31,33-37H,8H2,1H3/t9-,16+,19+,20-,21+,22+,23-,25+,26-,27+/m1/s1 |
| SMILES |
CC1O[C@@H](OC2[C@@H](O)[C@H](O)C(CO)O[C@H]2c2c(O)cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Prosopis strombulifera  | Ref. |
| Plantae | Fabaceae | Sophora microphylla  | Ref. |
| Plantae | Gentianaceae | Tripterospermum japonicum | Ref. |
| Plantae | Poaceae | Arrhenatherum spp. | Ref. |
| Plantae | Poaceae | Avena spp. | Ref. |
| Plantae | Podocarpaceae | Podocarpus totara  | Ref. |
| Plantae | Ruscaceae | Ruscus aculeatus  | Ref. |
| Plantae | Rutaceae | Fortunella japonica  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Ruscus aculeatus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Chopin,Phytochem.,16,(1977),2041
Kumamot,Agric.Biol.Chem.,49,(1985),2613 |
|---|
|