| Name |
Isoorientin 2''-O-xyloside Homoadonivernith Homoadonivernite |
| Formula |
C26H28O15 |
| Mw |
580.14282023 |
| CAS RN |
27708-61-8 |
| C_ID |
C00006170
, 
|
| InChIKey |
FGYOJUYXCCFUMF-FXUCZLPNNA-N |
| InChICode |
InChI=1S/C26H28O15/c27-6-16-20(34)22(36)25(41-26-23(37)19(33)13(32)7-38-26)24(40-16)18-12(31)5-15-17(21(18)35)11(30)4-14(39-15)8-1-2-9(28)10(29)3-8/h1-5,13,16,19-20,22-29,31-37H,6-7H2/t13-,16-,19-,20-,22+,23-,24+,25+,26-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O[C@@H]3OC[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Silene bupleuroides | Ref. |
| Plantae | Caryophyllaceae | Silene chlorifolia | Ref. |
| Plantae | Caryophyllaceae | Silene compacta | Ref. |
| Plantae | Caryophyllaceae | Silene cretica | Ref. |
| Plantae | Caryophyllaceae | Silene cubanensis | Ref. |
| Plantae | Caryophyllaceae | Silene polaris | Ref. |
| Plantae | Fabaceae | Desmodium canadense | Ref. |
| Plantae | Fabaceae | Lespedeza davurica  | Ref. |
| Plantae | Oxalidaceae | Oxalis triangularis | Ref. |
|
|
zoom in
| Organism | Lespedeza davurica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Chernobrovaya,Khim.Prir.Soedin.,(1973),801
Matsuzaki,Shoyakugaku Zasshi,44,(1990),251 |
|---|
|