| Name |
Quercetin 3,4'-di-O-beta-D-glucopyranoside Quercetin 3,4'-di-O-beta-D-glucopyranoside Quercetin 3,4'-diglucoside |
| Formula |
C27H30O17 |
| Mw |
626.14829954 |
| CAS RN |
29125-80-2 |
| C_ID |
C00005436
, 
|
| InChIKey |
RPVIQWDFJPYNJM-MAUJFVQSNA-N |
| InChICode |
InChI=1S/C27H30O17/c28-6-14-17(33)20(36)22(38)26(42-14)41-12-2-1-8(3-10(12)31)24-25(19(35)16-11(32)4-9(30)5-13(16)40-24)44-27-23(39)21(37)18(34)15(7-29)43-27/h1-5,14-15,17-18,20-23,26-34,36-39H,6-7H2/t14-,15-,17-,18-,20-,21-,22-,23-,26-,27+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium tuberosum  | Ref. |
| Plantae | Cruciferae | Crambe tataria | Ref. |
| Plantae | Cruciferae | Sisymbrium gilliesii | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Iridaceae | Crocus antalyensis | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Vitaceae | Vitis sp. | Ref. |
|
|
zoom in
| Organism | Vitis sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Herrmann,Arch.Pharm.(Berl.),291,(1958),238
Aguinagalde,Phytochem.,21,(1982),2875 |
|---|
|