| Name |
Herbacetin 7-glucoside Isoarticulatin |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
35815-07-7 |
| C_ID |
C00005337
, 
|
| InChIKey |
RSPZVQZNRINVPE-IYJXHOEWNA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-11-13(25)16(28)18(30)21(32-11)31-10-5-9(24)12-15(27)17(29)19(33-20(12)14(10)26)7-1-3-8(23)4-2-7/h1-5,11,13,16,18,21-26,28-30H,6H2/t11-,13-,16+,18-,21-/m1/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2c(O)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ephedraceae | Ephedra alata | Ref. |
| Plantae | Ephedraceae | Ephedra lomatolepis | Ref. |
| Plantae | Equisetaceae | Equisetum arvense  | Ref. |
| Plantae | Equisetaceae | Equisetum fluviatile | Ref. |
| Plantae | Equisetaceae | Equisetum hiemale | Ref. |
| Plantae | Malvaceae | Gossypium herbaceum  | Ref. |
| Plantae | Malvaceae | Gossypium indicum  | Ref. |
| Plantae | Phrymaceae | Mimulus luteus | Ref. |
|
|
zoom in
| Organism | Mimulus luteus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Harborne,Phytochem.,8,(1969),177
Saleh,Phytochem.,11,(1972),1095 |
|---|
|