| Name |
Kaempferol 3-rutinoside-7-rhamnoside |
| Formula |
C33H40O19 |
| Mw |
740.2163791 |
| CAS RN |
57526-56-4 |
| C_ID |
C00005240
, 
|
| InChIKey |
PEFASEPMJYRQBW-AYRALAJENA-N |
| InChICode |
InChI=1S/C33H40O19/c1-10-19(36)23(40)26(43)31(47-10)46-9-17-21(38)25(42)28(45)33(51-17)52-30-22(39)18-15(35)7-14(49-32-27(44)24(41)20(37)11(2)48-32)8-16(18)50-29(30)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-28,31-38,40-45H,9H2,1-2H3/t10-,11+,17+,19-,20-,21+,23-,24-,25+,26+,27+,28+,31+,32-,33-/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O[C@@H]5OC(C)[C@H](O)[C@H](O)C5O)cc(O)c4c3=O)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Lepidium syvaschicum | Ref. |
| Plantae | Equisetaceae | Equisetum spp. | Ref. |
| Plantae | Fabaceae | Astragalus cicer | Ref. |
| Plantae | Fabaceae | Bauhinia candicans | Ref. |
| Plantae | Fabaceae | Lens esculenta  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Gentianaceae | Eustoma grandiflorum | Ref. |
| Plantae | Hyacinthaceae | Urginea maritima  | Ref. |
|
|
zoom in
| Organism | Urginea maritima | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Aly,Phytochem.,14,(1975),1613
Markham,Tetrahedron,34,(1978),1389 |
|---|
|