| Name |
Kaempferol 3-O-gentiobioside Kaempferol 3-gentiobioside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
22149-35-5 |
| C_ID |
C00005166
, 
|
| InChIKey |
BITPRCODIALMOV-MAUJFVQSNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-14-17(32)20(35)22(37)26(41-14)39-8-15-18(33)21(36)23(38)27(42-15)43-25-19(34)16-12(31)5-11(30)6-13(16)40-24(25)9-1-3-10(29)4-2-9/h1-6,14-15,17-18,20-23,26-33,35-38H,7-8H2/t14-,15+,17+,18+,20+,21+,22-,23+,26+,27-/m0/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO[C@@H]3OC(CO)[C@@H](O)C(O)C3O)[C@@H](O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum dilatum | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Styphnolobium japonicum | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Papaveraceae | Meconopsis betonicifolia | Ref. |
| Plantae | Papaveraceae | Meconopsis grandis | Ref. |
| Plantae | Papaveraceae | Meconopsis horridula | Ref. |
| Plantae | Primulaceae | Primula sinensis | Ref. |
| Plantae | Rosaceae | Sorbus pendula | Ref. |
| Plantae | Zygophyllaceae | Tribulus longipetalus | Ref. |
| Plantae | Zygophyllaceae | Tribulus pentandrus | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
|
|
zoom in
| Organism | Meconopsis horridula | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Harborne,Biochem.J.,78,(1961),298
Wagner,Chem.Ber.,101,(1968),3419 |
|---|
|