| Name |
Gossypetin 3,7,8,3',4'-pentamethyl ether
5-Hydroxy-3,7,8,3',4'-pentamethoxyflavone
2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C20H20O8 |
| Mw |
388.11581762 |
| CAS RN |
14965-12-9 |
| C_ID |
C00004744
, 
|
| InChIKey |
NPMMYTVKEWLZKD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O8/c1-23-12-7-6-10(8-13(12)24-2)17-20(27-5)16(22)15-11(21)9-14(25-3)18(26-4)19(15)28-17/h6-9,21H,1-5H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(OC)cc(O)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum foetidum  | Ref. |
| Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
| Plantae | Cistaceae | Cistus albanicus | Ref. |
| Plantae | Euphorbiaceae | Ricinocarpos stylosus | Ref. |
| Plantae | Labiatae | Cyanostegia spp. | Ref. |
| Plantae | Rutaceae | Citrus reticulata | Ref. |
| Plantae | Rutaceae | Citrus sinensis | Ref. |
| Plantae | Rutaceae | Micromelum zeylanicum | Ref. |
| Plantae | Rutaceae | Murraya paniculata | Ref. |
| Plantae | Solanaceae | Solanum paludosum | Ref. |
|
|
zoom in
| Organism | Micromelum zeylanicum |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Henrick,Aust.J.Chem.,17,(1964),934 |
|---|
|
