| Name |
Eupatin |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
19587-65-6 |
| C_ID |
C00004698
, 
|
| InChIKey |
ZZEQOHMDRQUMMH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-10-5-4-8(6-9(10)19)17-16(22)14(20)13-11(26-17)7-12(24-2)18(25-3)15(13)21/h4-7,19,21-22H,1-3H3 |
| SMILES |
COc1ccc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Brickellia baccharidea | Ref. |
| Plantae | Asteraceae | Eupatorium semiserratum | Ref. |
| Plantae | Asteraceae | Helianthus glaucophyllus | Ref. |
| Plantae | Asteraceae | Heterotheca grandiflora | Ref. |
| Plantae | Asteraceae | Pericome caudata | Ref. |
| Plantae | Betulaceae | Alnus glutinosa  | Ref. |
| Plantae | Betulaceae | Alnus koehnei | Ref. |
|
|
zoom in
| Organism | Alnus koehnei | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kupchan,J.Org.Chem.,34,(1969),1460 |
|---|
|