| Name |
Quercetin 7,3',4'-trimethyl ether 3,5-Dihydroxy-7,3',4'-trimethoxyflavone 2-(3,4-Dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
6068-80-0 |
| C_ID |
C00004649
, 
|
| InChIKey |
OEEUHNAUMMATJT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-10-7-11(19)15-14(8-10)25-18(17(21)16(15)20)9-4-5-12(23-2)13(6-9)24-3/h4-8,19,21H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chromolaena odorata  | Ref. |
| Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
| Plantae | Asteraceae | Haplopappus sp. | Ref. |
| Plantae | Cistaceae | Cistus spp. | Ref. |
| Plantae | Crassulaceae | Aeonium arboreum | Ref. |
| Plantae | Geraniaceae | Geranium spp. | Ref. |
| Plantae | Hydrophyllaceae | Wigandia urens | Ref. |
| Plantae | Lennoaceae | Lennoa madreporoides | Ref. |
| Plantae | Malvaceae | Kitaibelia vitifolia | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Solanaceae | Solanum pennellii | Ref. |
| Plantae | Zingiberaceae | Amomum koenigii | Ref. |
| Plantae | Zygophyllaceae | Larrea cuneifolia  | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
|
|
zoom in
| Organism | Lennoa madreporoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wollenweber,Tetrahedron Lett.,(1970),1601 |
|---|
|