| Name |
Herbacetin 3,8,4'-trimethyl ether 5,7-Dihydroxy-3,8,4'-trimethoxyflavone 3,8,4'-Trimethylherbacetin 5,7-dDihydroxy-3,8-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C18H16O7 |
| Mw |
344.08960287 |
| CAS RN |
1570-09-8 |
| C_ID |
C00004621
, 
|
| InChIKey |
RXQVMRRNRHSOTC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O7/c1-22-10-6-4-9(5-7-10)15-18(24-3)14(21)13-11(19)8-12(20)16(23-2)17(13)25-15/h4-8,19-20H,1-3H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(O)cc(O)c3c(=O)c2OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Conyza sticta | Ref. |
| Plantae | Asteraceae | Conyza stricta  | Ref. |
| Plantae | Asteraceae | Encelia spp. | Ref. |
| Plantae | Asteraceae | Haplopappus deserticola  | Ref. |
| Plantae | Asteraceae | Helichrysum foetidum  | Ref. |
| Plantae | Asteraceae | Ozothamnus obcordatus | Ref. |
| Plantae | Calceolariaceae | Calceolaria chelidonioides | Ref. |
| Plantae | Cistaceae | Cistus parviflorus | Ref. |
| Plantae | Euphorbiaceae | Beyeria sp. | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Pteridaceae | Pityrogramma triangularis | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
| - | - | Currania robertiana | Ref. |
|
|
zoom in
| Organism | Cistus parviflorus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Dawson,Aust.J.Chem.,18,(1965),1871
Horie,Bull.Chem.Soc.Jpn,55,(1982),2933 |
|---|
|