| Name |
4',7-Dihydroxyflavonol Resokaempferol |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
2034-65-3 |
| C_ID |
C00004540
, 
|
| InChIKey |
OBWHQJYOOCRPST-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)15-14(19)13(18)11-6-5-10(17)7-12(11)20-15/h1-7,16-17,19H |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus spp. | Ref. |
| Plantae | Anacardiaceae | Schinopsis lorentzii  | Ref. |
| Plantae | Fabaceae | Acacia spp.  | Ref. |
| Plantae | Fabaceae | Anthyllis vulneraria  | Ref. |
| Plantae | Fabaceae | Baptisia calycosa | Ref. |
| Plantae | Fabaceae | Baptisia lecontei | Ref. |
| Plantae | Fabaceae | Baptisia simplicifolia | Ref. |
| Plantae | Fabaceae | Butea spp. | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Dorycnium pentaphyllum | Ref. |
| Plantae | Fabaceae | Lathyrus pratensis | Ref. |
| Plantae | Fabaceae | Lens culinaris  | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Lotus maritimus | Ref. |
| Plantae | Fabaceae | Millettia spp. | Ref. |
| Plantae | Fabaceae | Platymiscium praecox | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
| Plantae | Fabaceae | Ulex spp. | Ref. |
| Plantae | Fabaceae | Umtiza listerana | Ref. |
|
|
zoom in
| Organism | Butea spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kirby,Biochem.J.,60,(1955),582
Wong,Phytochem.,4,(1965),89 |
|---|
|