| Name |
Sudachitin Menthocubanone Menthokubanone 4',5,7-Trihydroxy-3',6,8-trimethoxyflavone 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
4281-28-1 |
| C_ID |
C00003928
, 
|
| InChIKey |
XRHHDQSPFPQKMS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-12-6-8(4-5-9(12)19)11-7-10(20)13-14(21)17(24-2)15(22)18(25-3)16(13)26-11/h4-7,19,21-22H,1-3H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(OC)c(O)c(OC)c3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia sarothrae | Ref. |
| Plantae | Asteraceae | Tithonia calva | Ref. |
| Plantae | Asteraceae | Viguiera rosei | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Labiatae | Mentha piperita L.var.prilwkskaya  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
|
|
zoom in
| Organism | Citrus sudachi | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Horie, Bull.Chem.Soc.Jpn,34,(1961),1547
Hradetzky,Naturforsch.C.,42,(1986),73 |
|---|
|