| Name |
Sideritiflavone 5,3',4'-Trihydroxy-6,7,8-trimethoxyflavone 2-(3,4-Dihydroxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
70360-12-2 |
| C_ID |
C00003927
, 
|
| InChIKey |
UWNUJPINKMRKKR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-16-14(22)13-11(21)7-12(8-4-5-9(19)10(20)6-8)26-15(13)17(24-2)18(16)25-3/h4-7,19-20,22H,1-3H3 |
| SMILES |
COc1c(OC)c(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Madia spp. | Ref. |
| Plantae | Asteraceae | Pteronia incana | Ref. |
| Plantae | Asteraceae | Wilkesia hobdyi | Ref. |
| Plantae | Labiatae | Isodon rubescens var.lushiensis | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Mentha spicata  | Ref. |
| Plantae | Labiatae | Sideritis angustifolia | Ref. |
| Plantae | Labiatae | Sideritis leucantha | Ref. |
| Plantae | Labiatae | Thymus herba-barona  | Ref. |
|
|
zoom in
| Organism | Sideritis angustifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Tomas,Phytochem.,18,(1979),185
Bohm,Phytochem.,29,(1990),1175 |
|---|
|