| Name |
Loganin |
| Formula |
C17H26O10 |
| Mw |
390.15259705 |
| CAS RN |
18524-94-2 |
| C_ID |
C00003088
, 
|
| InChIKey |
AMBQHHVBBHTQBF-FJBRCSOCNA-N |
| InChICode |
InChI=1S/C17H26O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,9-14,16-22H,3-4H2,1-2H3/t6-,7+,9-,10+,11+,12+,13-,14+,16-,17-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)[C@@H]2[C@@H](C)[C@@H](O)C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica Thunb.  | Ref. |
| Plantae | -- | Lonicera quinquelocularis | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Caprifoliaceae | Patrinia villosa | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus controversa  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asper | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa japonica | Ref. |
| Plantae | Gentianaceae | Centaurium erythraea  | Ref. |
| Plantae | Gentianaceae | Gentiana loureirii | Ref. |
| Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
| Plantae | Gentianaceae | Gentiana straminea  | Ref. |
| Plantae | Gentianaceae | Gentiana verna | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Longaniaceae | Strychnos axillaris | Ref. |
| Plantae | Longaniaceae | Strychnos ignatii  | Ref. |
| Plantae | Longaniaceae | Strychnos lucida | Ref. |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Menyanthaceae | Menyanthes trifoliata  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum hemsleyi Yamamoto | Ref. |
| Plantae | Oleaceae | Jasminum officinale  | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis L.  | Ref. |
| Plantae | Oleaceae | Osmanthus austrocaledonicus (Vieill.) Knobl. | Ref. |
| Plantae | Oleaceae | Picconia excelsa (Aiton) DC. | Ref. |
| Plantae | Rubiaceae | Adina racemosa | Ref. |
| Plantae | Rubiaceae | Calycophyllum spruceanum  | Ref. |
| Plantae | Rubiaceae | Neonauclea sessilifolia  | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Sinoadina Racemosa | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Verbenaceae | Lippia graveolens  | Ref. |
| - | - | Sertia mussotii | Ref. |
|
|
zoom in
| Organism | Dipsacus asperoides | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Huang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 247.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Kumar, et al., Phytochemistry, 53, (2000), 499.
KITAJIMA, et al., Chem Pharm Bull, 53, (2005), 1355.
Itoh, et al., Journal of Natural Products, 66, (2003), 1212.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|