| Name |
Procyanidin B4 Catechin-(4alpha->8)-epicatechin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
29106-51-2 |
| C_ID |
C00002935
, 
|
| InChIKey |
XFZJEEAOWLFHDH-MDUHQJCGNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27-,28-,29+/m0/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum burkwoodii | Ref. |
| Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
| Plantae | Ericaceae | Vaccinium myritillus | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Fabaceae | Arachis hypogaea  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Malvaceae | Theobroma cacao  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Crataegus oxyacantha  | Ref. |
| Plantae | Rosaceae | Malus spp.  | Ref. |
| Plantae | Rosaceae | Rubus fruticosus  | Ref. |
| Plantae | Rosaceae | Rubus idaeus  | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Theobroma cacao | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Thompson,J.Chem.Soc.Perkin Trans.,1,(1972),1387 |
|---|
|