| Name |
Cinchonain Ia |
| Formula |
C24H20O9 |
| Mw |
452.11073224 |
| CAS RN |
85081-24-9 |
| C_ID |
C00002913
, 
|
| InChIKey |
LKCOZWLUAKSRQM-XCAFOYTQNA-N |
| InChICode |
InChI=1S/C24H20O9/c25-14-3-1-10(5-17(14)28)12-8-21(31)32-20-9-16(27)13-7-19(30)23(33-24(13)22(12)20)11-2-4-15(26)18(29)6-11/h1-6,9,12,19,23,25-30H,7-8H2/t12-,19-,23-/m1/s1 |
| SMILES |
O=C1C[C@@H](c2ccc(O)c(O)c2)c2c(cc(O)c3c2O[C@H](c2ccc(O)c(O)c2)[C@H](O)C3)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fagaceae | Castanopsis hystrix | Ref. |
| Plantae | Meliaceae | Trichilia catigua | Ref. |
| Plantae | Phyllocladaceae | Phyllocladus trichomanoides  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| Plantae | Rhizophoraceae | Kandelia candel | Ref. |
| Plantae | Rosaceae | Rhaphiolepis umbellata | Ref. |
| Plantae | Rubiaceae | Cinchona succirubra  | Ref. |
| Plantae | Rubiaceae | Uncaria gambir  | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla  | Ref. |
|
|
zoom in
| Organism | Uncaria gambir | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Nonaka,Chem.Pharm.Bull.,30,(1982),4268
Chen,Phytochem.,33,(1993),183 |
|---|
|