| Name |
Methyl caffeate |
| Formula |
C10H10O4 |
| Mw |
194.05790881 |
| CAS RN |
3843-74-1 |
| C_ID |
C00002759
, 
|
| InChIKey |
OCNYGKNIVPVPPX-HWKANZROSA-N |
| InChICode |
InChI=1S/C10H10O4/c1-14-10(13)5-3-7-2-4-8(11)9(12)6-7/h2-6,11-12H,1H3/b5-3+ |
| SMILES |
COC(=O)/C=C/c1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Chaerophyllum hirsutum | Ref. |
| Plantae | Asteraceae | Artemisia apiacea  | Ref. |
| Plantae | Asteraceae | Bedfordia salicina | Ref. |
| Plantae | Asteraceae | Gaillardia pulchella | Ref. |
| Plantae | Asteraceae | Tanacetum odessanum | Ref. |
| Plantae | Convolvulaceae | Pharbitis nil  | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Ranunculaceae | Actaea racemosa  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Thymelaeaceae | Daphne feddei | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| - | - | Gochnatra rusbyana | Ref. |
| - | - | Pseudostiffita kingii | Ref. |
|
|
zoom in
| Organism | Abutilon indicum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|