| Name |
Sativan (-)-Sativan (-)-Sativin |
| Formula |
C17H18O4 |
| Mw |
286.12050906 |
| CAS RN |
41743-86-6 |
| C_ID |
C00002570
, 
|
| InChIKey |
TUXCLJQCYVCGDW-STGVRZAANA-N |
| InChICode |
InChI=1S/C17H18O4/c1-19-14-5-6-15(17(9-14)20-2)12-7-11-3-4-13(18)8-16(11)21-10-12/h3-6,8-9,12,18H,7,10H2,1-2H3/t12-/m0/s1 |
| SMILES |
COc1ccc([C@@H]2COc3cc(O)ccc3C2)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Baphia nitida  | Ref. |
| Plantae | Fabaceae | Caragana tibetica KOM. | Ref. |
| Plantae | Fabaceae | Derris amazonica | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Lotus pedunculatus | Ref. |
| Plantae | Fabaceae | Lotus spp. | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago lupulina  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago spp. | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Millettia pachyloba | Ref. |
| Plantae | Fabaceae | Trifolium spp. | Ref. |
| Plantae | Fabaceae | Trigonella spp. | Ref. |
|
|
zoom in
| Organism | Medicago lupulina | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|