| Name |
Rotenone Tubotoxin Nicouline |
| Formula |
C23H22O6 |
| Mw |
394.14163844 |
| CAS RN |
83-79-4 |
| C_ID |
C00002568
, 
|
| InChIKey |
JUVIOZPCNVVQFO-BXPNWFCHNA-N |
| InChICode |
InChI=1S/C23H22O6/c1-11(2)16-8-14-15(28-16)6-5-12-22(24)21-13-7-18(25-3)19(26-4)9-17(13)27-10-20(21)29-23(12)14/h5-7,9,16,20-21H,1,8,10H2,2-4H3/t16-,20-,21+/m1/s1 |
| SMILES |
C=C(C)[C@H]1Cc2c(ccc3c2O[C@@H]2COc4cc(OC)c(OC)cc4[C@@H]2C3=O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Derris eclipta | Ref. |
| Plantae | Fabaceae | Derris elliptica  | Ref. |
| Plantae | Fabaceae | Derris malaccensis | Ref. |
| Plantae | Fabaceae | Derris trifoliata  | Ref. |
| Plantae | Fabaceae | Lonchocarpus spp. | Ref. |
| Plantae | Fabaceae | Millettia pachycarpa | Ref. |
| Plantae | Fabaceae | Millettia pervilleana | Ref. |
| Plantae | Fabaceae | Millettia reticulata  | Ref. |
| Plantae | Fabaceae | Millettia spp. | Ref. |
| Plantae | Fabaceae | Pachyrhizus erosus  | Ref. |
| Plantae | Fabaceae | Pachyrrhizus erosus  | Ref. |
| Plantae | Fabaceae | Piscidia erythrina | Ref. |
| Plantae | Fabaceae | Piscidia piscipula  | Ref. |
| Plantae | Fabaceae | Tephrosia interrupta Engl.  | Ref. |
| Plantae | Fabaceae | Tephrosia linearis (Willd.) Pers.  | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Fabaceae | Tephrosia spp. | Ref. |
| Plantae | Scrophulariaceae | Verbascum thapsus  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| - | - | Leguminosae | Ref. |
| - | - | Milletia pachycarpa | Ref. |
| - | - | Papilionoideae | Ref. |
|
|
zoom in
| Organism | Millettia pachycarpa | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
PHRUTIVORAPONGKUL, et al., Chem Pharm Bull, 50, (2002), 534.
Granell, et al., Planta Med, 70, (2004), 266.
Ito, et al., Planta Med, 70, (2004), 585.
Barrachina, et al., Planta Med, 70, (2004), 866.
Betancur-Galvis, et al., Planta Med, 69, (2003), 177.
Gertsch, et al., Planta Med, 69, (2003), 420 |
|---|
|