| Name |
Prunetin Prunusetin Padmakastein 5,4'-Dihydroxy-7-methoxyisoflavone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
552-59-0 |
| C_ID |
C00002564
, 
|
| InChIKey |
KQMVAGISDHMXJJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)c(-c3ccc(O)cc3)coc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Streptomycetaceae | Streptomyces sp. M491 | Ref. |
| Plantae | Bignoniaceae | Oroxylum indicum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Dalbergia miscolobium | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia violacea | Ref. |
| Plantae | Fabaceae | Genista carinalis | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Pterocarpus angolensis  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Myristicaceae | Myristica malabarica  | Ref. |
| Plantae | Ochnaceae | Ochna calodendron | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Prunus puddum  | Ref. |
| Plantae | Rosaceae | Prunus puddun | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Rosaceae | Prunus verecunda | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| - | - | Occurs in several | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
King,J.Chem.Soc.,(1952),3211
King,J.Chem.Soc.,(1952),1920 |
|---|
|