| Name |
Isobavachalcone Corylifolinin 2',4,4'-Trihydroxy-3'-(3-methyl-2-butenyl)chalcone |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
20784-50-3 |
| C_ID |
C00002381
, 
|
| InChIKey |
DUWPGRAKHMEPCM-IZZDOVSWSA-N |
| InChICode |
InChI=1S/C20H20O4/c1-13(2)3-9-16-19(23)12-10-17(20(16)24)18(22)11-6-14-4-7-15(21)8-5-14/h3-8,10-12,21,23-24H,9H2,1-2H3/b11-6+ |
| SMILES |
CC(C)=CCc1c(O)ccc(C(=O)/C=C/c2ccc(O)cc2)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica keiskei  | Ref. |
| Plantae | Fabaceae | Cullen corylifolium | Ref. |
| Plantae | Fabaceae | Erythrina burttii | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
| Plantae | Fabaceae | Lonchocarpus neuroscapha | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Sophora prostrata | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Moraceae | Dorstenia poinsettifolia | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
|
|
zoom in
| Organism | Lonchocarpus neuroscapha | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Delle Monache,Gazz,Chim.Ital.,104,(1974),861 |
|---|
|