| Name |
Tomatidine |
| Formula |
C27H45NO2 |
| Mw |
415.34502969 |
| CAS RN |
77-59-8 |
| C_ID |
C00002267
, 
|
| InChIKey |
XYNPYHXGMWJBLV-MUEPWYEINA-N |
| InChICode |
InChI=1S/C27H45NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h16-24,28-29H,5-15H2,1-4H3/t16-,17-,18-,19-,20+,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| SMILES |
C[C@H]1CC[C@]2(NC1)O[C@H]1C[C@H]3[C@@H]4CC[C@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Lycopersicon esculentum  | Ref. |
| Plantae | Solanaceae | Solanum brevidens | Ref. |
| Plantae | Solanaceae | Solanum demissum | Ref. |
| Plantae | Solanaceae | Solanum kieseritzkii | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum melongena  | Ref. |
| Plantae | Solanaceae | Solanum pimpinellifolium Jusl.Mill.  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Solanum tuberosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|