| Name |
Supinine |
| Formula |
C15H25NO4 |
| Mw |
283.17835829 |
| CAS RN |
551-58-6 |
| C_ID |
C00002121
, 
|
| InChIKey |
DRVWTOSBCBKXOR-XKBCNMOMNA-N |
| InChICode |
InChI=1S/C15H25NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h6,10-11,13,17,19H,4-5,7-9H2,1-3H3/t11-,13+,15+/m1/s1 |
| SMILES |
CC(C)[C@@](O)(C(=O)OCC1=CCN2CCC[C@@H]12)[C@@H](C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium cannabinum  | Ref. |
| Plantae | Asteraceae | Eupatorium serotinum | Ref. |
| Plantae | Asteraceae | Eupatorium stoechadadosum | Ref. |
| Plantae | Asteraceae | Eupatorium stoechadosmum | Ref. |
| Plantae | Boraginaceae | Arnebia decumbens | Ref. |
| Plantae | Boraginaceae | Heliotropium bacciferum  | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutissimum | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Boraginaceae | Heliotropium supinum | Ref. |
| Plantae | Boraginaceae | Heliotropium transalpinum | Ref. |
| Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
| Plantae | Heliotropiaceae | Tournefortia zeylanicum | Ref. |
|
|
zoom in
| Organism | Heliotropium hirsutissimum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|