| Name |
Lycoricidinol
Narciclasine |
| Formula |
C14H13NO7 |
| Mw |
307.06920178 |
| CAS RN |
29477-83-6 |
| C_ID |
C00001577
, 
|
| InChIKey |
LZAZURSABQIKGB-YSDXCPGDNA-N |
| InChICode |
InChI=1S/C14H13NO7/c16-6-1-5-4-2-7-13(22-3-21-7)11(18)8(4)14(20)15-9(5)12(19)10(6)17/h1-2,6,9-10,12,16-19H,3H2,(H,15,20)/t6-,9+,10+,12-/m0/s1 |
| SMILES |
O=C1N[C@@H]2C(=C[C@H](O)[C@@H](O)[C@H]2O)c2cc3c(c(O)c21)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Haemanthus kalbreyeri | Ref. |
| Plantae | Amaryllidaceae | Lycoris longituba | Ref. |
| Plantae | Amaryllidaceae | Lycoris radiata  | Ref. |
| Plantae | Amaryllidaceae | Lycoris sanguinea | Ref. |
| Plantae | Amaryllidaceae | Narcissus cyclamineus | Ref. |
| Plantae | Amaryllidaceae | Narcissus jonquilla | Ref. |
| Plantae | Amaryllidaceae | Narcissus poeticus | Ref. |
| Plantae | Amaryllidaceae | Narcissus pseudonarcissus | Ref. |
| Plantae | Amaryllidaceae | Narcissus spp. | Ref. |
| Plantae | Amaryllidaceae | Narcissus tarzettus | Ref. |
| - | - | Brachystola magna | Ref. |
|
|
zoom in
| Organism | Narcissus pseudonarcissus |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
