| Name |
UDP-D-glucose Uridine diphosphate glucose UDP-glucose |
| Formula |
C15H24N2O17P2 |
| Mw |
566.05502034 |
| CAS RN |
133-89-1 |
| C_ID |
C00001514
, 
|
| InChIKey |
HSCJRCZFDFQWRP-AUEXVISRNA-N |
| InChICode |
InChI=1S/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6+,8+,9-,10-,11-,12-,13-,14+/m0/s1 |
| SMILES |
O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3OC(CO)[C@@H](O)[C@H](O)C3O)[C@H](O)C2O)c(=O)[nH]1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| - | - | occurs in many plants | Ref. |
|
|
zoom in
| Organism | occurs in many plants | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|