| Name |
Lactose |
| Formula |
C12H22O11 |
| Mw |
342.11621155 |
| CAS RN |
63-42-3 |
| C_ID |
C00001136
, 
|
| InChIKey |
GUBGYTABKSRVRQ-QGENSXPJNA-N |
| InChICode |
InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4+,5+,6-,7+,8-,9-,10-,11+,12-/m0/s1 |
| SMILES |
OCC1O[C@@H](O)C(O)C(O)C1O[C@@H]1OC(CO)[C@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Fabaceae | Cassia multijuga | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Oleaceae | Forsythia spp. | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Sapotaceae | Achras sapota  | Ref. |
|
|
zoom in
| Organism | Forsythia suspensa | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|