| Name |
Ginkgetin 7,4'-Dimethylamentoflavone Amentoflavone 7'',4'''-dimethyl ether |
| Formula |
C32H22O10 |
| Mw |
566.12129692 |
| CAS RN |
481-46-9 |
| C_ID |
C00001044
, 
|
| InChIKey |
AIFCFBUSLAEIBR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C32H22O10/c1-39-18-10-20(34)30-23(37)13-27(41-28(30)11-18)16-5-8-25(40-2)19(9-16)29-21(35)12-22(36)31-24(38)14-26(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-36H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(OC)c(-c4c(O)cc(O)c5c(=O)cc(-c6ccc(O)cc6)oc45)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Cycadaceae | Cycas spp. | Ref. |
| Plantae | Euphorbiaceae | Elateriospermum tapos  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
| Plantae | Podocarpaceae | Falcatifolium spp. | Ref. |
| Plantae | Podocarpaceae | Halocarpus spp. | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Taxus buccata | Ref. |
| Plantae | Taxaceae | Taxus canadensis | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| Plantae | Taxaceae | Taxus wallichini | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Taxaceae | Torreya nucifera  | Ref. |
| Plantae | Taxodiaceae | Metasequoia glyptostroboides Hu et Cheng. | Ref. |
| Plantae | Zamiaceae | Dioon spp. | Ref. |
| Plantae | Zamiaceae | Zamia angustifolia  | Ref. |
| - | - | Selaginella moellendorffii | Ref. |
|
|
zoom in
| Organism | Halocarpus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Baker,J.Chem.Soc.,(1963),1477 |
|---|
|