| Name |
Apiin 7-(2-Apiosylglucosyl)apigenin |
| Formula |
C26H28O14 |
| Mw |
564.14790561 |
| CAS RN |
26544-34-3 |
| C_ID |
C00001019
, 
|
| InChIKey |
NTDLXWMIWOECHG-IKPODFJPNA-N |
| InChICode |
InChI=1S/C26H28O14/c27-8-18-20(32)21(33)22(40-25-23(34)26(35,9-28)10-36-25)24(39-18)37-13-5-14(30)19-15(31)7-16(38-17(19)6-13)11-1-3-12(29)4-2-11/h1-7,18,20-25,27-30,32-35H,8-10H2/t18-,20+,21-,22+,23+,24+,25-,26+/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O[C@@H]3OCC(O)(CO)[C@@H]3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Asteraceae | Anthemis nobilis  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Fabaceae | Crotalaria micans | Ref. |
| Plantae | Fabaceae | Vicia balansae | Ref. |
| Plantae | Fabaceae | Vicia hirsuta  | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| - | - | Roman chamomile | Ref. |
|
|
zoom in
| Organism | Lawsonia alba | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|