| Name |
Chavicol p-Hydroxyallylbenzene |
| Formula |
C9H10O |
| Mw |
134.07316494 |
| CAS RN |
501-92-8 |
| C_ID |
C00000621
, 
|
| InChIKey |
RGIBXDHONMXTLI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O/c1-2-3-8-4-6-9(10)7-5-8/h2,4-7,10H,1,3H2 |
| SMILES |
C=CCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Piperaceae | Piper betle  | Ref. |
| Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
| - | - | Jackiella javanica | Ref. |
|
|
zoom in
| Organism | Jackiella javanica | | Reference | Nagashima,Phytochem.,29,(1990),2169
Asakawa,Progress in the Chemistry of Organic Natural Products.Springer-Verlag Wien,vol 65,(1995) |
|---|
|