| Name |
Daidzein 7,4'-Dihydroxyisoflavone |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
486-66-8 |
| C_ID |
C00009380
, 
|
| InChIKey |
ZQSIJRDFPHDXIC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-8,16-17H |
| SMILES |
O=c1c(-c2ccc(O)cc2)coc2cc(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Streptomycetaceae | Streptomyces xanthophaeus MD865-C3 | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Albizia procera  | Ref. |
| Plantae | Fabaceae | Arachis hypogaea  | Ref. |
| Plantae | Fabaceae | Cajanus cajan  | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida  | Ref. |
| Plantae | Fabaceae | Dalbergia ecastaphyllum  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Erythrina crista-galli  | Ref. |
| Plantae | Fabaceae | Erythrina indica  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina orientalis | Ref. |
| Plantae | Fabaceae | Euchresta formosana | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Genista tinctoria  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Pericopsis angolensis Baker.  | Ref. |
| Plantae | Fabaceae | Pericopsis eleta | Ref. |
| Plantae | Fabaceae | Pericopsis laxiflora Benth.  | Ref. |
| Plantae | Fabaceae | Pericopsis mooniana | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Fabaceae | Pueraria calycina | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Pueraria edulis | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Pueraria mirifica  | Ref. |
| Plantae | Fabaceae | Pueraria peduncularis | Ref. |
| Plantae | Fabaceae | Pueraria Phaseoloides | Ref. |
| Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
| Plantae | Fabaceae | Pueraria tuberosa  | Ref. |
| Plantae | Fabaceae | Retama raetam  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium riograndense | Ref. |
| Plantae | Fabaceae | Ulex europaeus  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Podocarpaceae | Podocarpus amarus | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Leguminosae | Ref. |
| - | - | Peuraria lobata | Ref. |
| - | - | Peuraria lobata var.thomsonii | Ref. |
| - | - | Peuraria omeinsis | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Moringa peregrine | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|