| Name |
Catalpol |
| Formula |
C15H22O10 |
| Mw |
362.12129692 |
| CAS RN |
2415-24-9 |
| C_ID |
C00003075
, 
|
| InChIKey |
LHDWRKICQLTVDL-ZFYHEPMXNA-N |
| InChICode |
InChI=1S/C15H22O10/c16-3-6-9(19)10(20)11(21)14(23-6)24-13-7-5(1-2-22-13)8(18)12-15(7,4-17)25-12/h1-2,5-14,16-21H,3-4H2/t5-,6+,7+,8-,9+,10-,11+,12-,13-,14-,15+/m0/s1 |
| SMILES |
OCC1O[C@@H](O[C@@H]2OC=C[C@H]3[C@H](O)[C@@H]4O[C@]4(CO)[C@@H]23)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Asystasia intrusa | Ref. |
| Plantae | Bignoniaceae | Argylia radiata | Ref. |
| Plantae | Bignoniaceae | Catalpa ovata  | Ref. |
| Plantae | Bignoniaceae | Catalpa spp. | Ref. |
| Plantae | Buddlejaceae | Buddleia globosa | Ref. |
| Plantae | Buddlejaceae | Buddleia variabilis | Ref. |
| Plantae | Buddlejaceae | Buddleja gloriosa | Ref. |
| Plantae | Buddlejaceae | Buddleja spp. | Ref. |
| Plantae | Buddlejaceae | Buddleja variabilis | Ref. |
| Plantae | Globulariaceae | Globularia trichosantha | Ref. |
| Plantae | Globulariaceae | Globularia vulgaris L. | Ref. |
| Plantae | Labiatae | Gmelina philippensis  | Ref. |
| Plantae | Labiatae | Scutellaria albida subsp.albida | Ref. |
| Plantae | Orobanchaceae | Castilleja integra | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Plantaginaceae | Aragoa cundinamarcensis | Ref. |
| Plantae | Plantaginaceae | Paederota lutea | Ref. |
| Plantae | Plantaginaceae | Penstemon secundiflorus | Ref. |
| Plantae | Plantaginaceae | Picrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Plantago altissima  | Ref. |
| Plantae | Plantaginaceae | Plantago amplexicaulis | Ref. |
| Plantae | Plantaginaceae | Plantago argentea | Ref. |
| Plantae | Plantaginaceae | Plantago atrata | Ref. |
| Plantae | Plantaginaceae | Plantago cornuti | Ref. |
| Plantae | Plantaginaceae | Plantago hookeriana | Ref. |
| Plantae | Plantaginaceae | Plantago lagopus | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago lundborgii | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Plantago nivalis | Ref. |
| Plantae | Plantaginaceae | Plantago ovata  | Ref. |
| Plantae | Plantaginaceae | Plantago patagonica | Ref. |
| Plantae | Plantaginaceae | Plantago spp. | Ref. |
| Plantae | Plantaginaceae | Plantago uniflora | Ref. |
| Plantae | Plantaginaceae | Veronica austriaca L.  | Ref. |
| Plantae | Plantaginaceae | Veronica bellidioides | Ref. |
| Plantae | Plantaginaceae | Veronica cuneifolia | Ref. |
| Plantae | Plantaginaceae | Veronica cymbalaria | Ref. |
| Plantae | Plantaginaceae | Veronica francispetae | Ref. |
| Plantae | Plantaginaceae | Veronica ligustrifolia A.Cunn | Ref. |
| Plantae | Plantaginaceae | Veronica longifolia | Ref. |
| Plantae | Plantaginaceae | Veronica pectinata | Ref. |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica salicifolia G. Forst. | Ref. |
| Plantae | Plantaginaceae | Veronica siaretensis | Ref. |
| Plantae | Plantaginaceae | Veronica spp. | Ref. |
| Plantae | Plantaginaceae | Veronicastrum sibiricum (L.) Pennell | Ref. |
| Plantae | Plantaginaceae | Veronicastrum virginicum (L.) Farw.  | Ref. |
| Plantae | Plantaginaceae | Veronica turrilliana | Ref. |
| Plantae | Plantaginaceae | Veronica x andersonii Lindl. et Pax | Ref. |
| Plantae | Plantaginaceae | Wulfenia baldaccii Degen | Ref. |
| Plantae | Plantaginaceae | Wulfenia blechicii Lakusic subsp. | Ref. |
| Plantae | Plantaginaceae | Wulfenia orientalis BOISS. | Ref. |
| Plantae | Poaceae | Tribolium castaneum | Ref. |
| Plantae | Ranunculaceae | Adonis sutchuenensis | Ref. |
| Plantae | Scrophulariaceae | Camptoloma lyperiiflorum (Vatke) Hillard | Ref. |
| Plantae | Scrophulariaceae | Oreosolen wattii | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scorodonia | Ref. |
| Plantae | Scrophulariaceae | Scrophularia trifoliata | Ref. |
| Plantae | Scrophulariaceae | Triaenophora rupestris | Ref. |
| Plantae | Scrophulariaceae | Verbascum lychnites | Ref. |
| Plantae | Scrophulariaceae | Verbascum thapsus  | Ref. |
| - | - | Asistasia intrusa | Ref. |
| - | - | Vernoica cymbalaria | Ref. |
|
|
zoom in
| Organism | Verbascum lychnites | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Tasdemir, et al., Phytochemistry, 66, (2005), 355.
Calixto, et al., Planta Med, 70, (2004), 93.
Helfrich, et al., Phytochemistry, 54, (2000), 191.
Kanchanapoom, et al., Chem Pharm Bull, 52, (2004), 980.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|