| Name |
Afzelin Kaempferol 3-O-rhamnoside Kaempferol 3-O-alpha-rhamnoside Kaempferol 3-O-alpha-L-rhamnopyranoside Kaempferol-3-rhamnoside Kaempherol 3-O-alpha-rhamnoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
482-39-3 |
| C_ID |
C00005140
, 
|
| InChIKey |
SOSLMHZOJATCCP-OVDJVLJZNA-N |
| InChICode |
InChI=1S/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15-,17+,18-,21-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus parviflora  | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Annonaceae | Guatteria rupestris | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Betulaceae | Alnus japonica  | Ref. |
| Plantae | Canellaceae | Warburgia stuhlmannii  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium murale  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus controversa  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cunoniaceae | Davidsonia pruriens  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Ephedraceae | Ephedra alata | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum subsessile | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lunulata  | Ref. |
| Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis  | Ref. |
| Plantae | Euphorbiaceae | Mallotus metcalfianus | Ref. |
| Plantae | Fabaceae | Afzelia spp. | Ref. |
| Plantae | Fabaceae | Cassia grandis  | Ref. |
| Plantae | Fabaceae | Flemingia stricta  | Ref. |
| Plantae | Fabaceae | Millettia zechiana | Ref. |
| Plantae | Fabaceae | Sindora siamensis | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Geraniaceae | Geranium rotundifolium  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris spp. | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Labiatae | Ajuga remota  | Ref. |
| Plantae | Lauraceae | Beilschmiedia miersii | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Loranthaceae | Dendrophthoe falcata  | Ref. |
| Plantae | Loranthaceae | Hyphear tanakae | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Nymphaeaceae | Nymphaea odorata  | Ref. |
| Plantae | Ochnaceae | Ochna beddomei  | Ref. |
| Plantae | Onagraceae | Heterogaura heterandra | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Piperaceae | Piper umbellatum  | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Polygalaceae | Polygala chinensis  | Ref. |
| Plantae | Resedaceae | Ochradenus baccatus  | Ref. |
| Plantae | Rosaceae | Agrimonia eupatoria  | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rubiaceae | Morinda morindoides | Ref. |
| Plantae | Rutaceae | Euodia alata | Ref. |
| Plantae | Rutaceae | Leptothyrsa sprucei | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Zanthoxylum culantrillo | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saxifragaceae | Heuchera spp. | Ref. |
| Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
| Plantae | Saxifragaceae | Rodgersia podophylla  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Zingiberaceae | Zingiber aromaticum  | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbe | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbet  | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
| - | - | Tapirira guianensis  | Ref. |
|
|
zoom in
| Organism | Rodgersia podophylla | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chi, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 233.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
KUROYANAGI, et al., Chem Pharm Bull, 53, (2005), 1519.
YUAN, et al., Chem Pharm Bull, 53, (2005), 1610.
Usia, et al., Journal of Natural Products, 65, (2002), 1079.
Chin, et al., Planta Med, 70, (2004), 576 |
|---|
|