| Name |
Lutein (all-E)-Lutein (3R,3'R,6'R)-beta,epsilon-Carotene-3,3'-diol all-trans-(+)-Xanthophyll |
| Formula |
C40H56O2 |
| Mw |
568.42803103 |
| CAS RN |
127-40-2 |
| C_ID |
C00003776
, 
|
| InChIKey |
KBPHJBAIARWVSC-MMZBKWJPNA-N |
| InChICode |
InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+,37-/m0/s1 |
| SMILES |
CC1=C[C@H](O)CC(C)(C)[C@H]1/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Bangiaceae | Porphyra tenera  | Ref. |
| -- | Rhodomelaceae | Polysiphonia brodiaei | Ref. |
| -- | Rhodomelaceae | Polysiphonia urceolata | Ref. |
| Animalia | Bagridae | Pelteobagrus nudiceps  | Ref. |
| Animalia | Bagridae | Pseudobagrus aurantiacus | Ref. |
| Animalia | Callichthyidae | Corydoras melanistius | Ref. |
| Animalia | Cyprinidae | Carassius auratus  | Ref. |
| Animalia | Ictaluridae | Ictalurus punctatus  | Ref. |
| Animalia | Malapteruridae | Malapterurus electricus | Ref. |
| Animalia | Penaeidae | Penaeus orientalis  | Ref. |
| Animalia | Siluridae | Silurus asotus  | Ref. |
| Animalia | Siluridae | Silurus biwaensis  | Ref. |
| Animalia | Siluridae | Silurus microdorsalis | Ref. |
| Plantae | Actinidiaceae | Actinidia chinensis  | Ref. |
| Plantae | Actinidiaceae | Actinidia deliciosa  | Ref. |
| Plantae | Actinidiaceae | Actinidia macrosperma | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Aristolochiaceae | Ceramium rubrum | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis L.  | Ref. |
| Plantae | Asteraceae | Dendranthema grandiflorum (Ramat.) Kitamura | Ref. |
| Plantae | Asteraceae | Helianthus annuus L.  | Ref. |
| Plantae | Asteraceae | Helianthus heterophyllus | Ref. |
| Plantae | Asteraceae | Tagetes erecta  | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Blechnaceae | Stenochlaena palustris | Ref. |
| Plantae | Bromeliaceae | Ananas comosus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cephalotaxaceae | Amentotaxus yunnanensis | Ref. |
| Plantae | Ceratophyllaceae | Ceratophyllum demersum  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Colchicaceae | Colchicum luteum Baker.  | Ref. |
| Plantae | Convolvulaceae | Cuscuta australis  | Ref. |
| Plantae | Convolvulaceae | Cuscuta japonica  | Ref. |
| Plantae | Corbiculidae | Corbicula japonica  | Ref. |
| Plantae | Corbiculidae | Corbicula sandai  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. gongylodes  | Ref. |
| Plantae | Cruciferae | Brassica rapa ssp. chinensis  | Ref. |
| Plantae | Cruciferae | Brassica spp. | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus L.  | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cyprinidae | Cyprinus carpio  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
| Plantae | Ericaceae | Vaccinium macrocarpon  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Malvaceae | Helicteres isora  | Ref. |
| Plantae | Moraceae | Dorstenia poinsettifolia | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pandanaceae | Pandanus tectorius  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Potamogetonaceae | Potamogeton perfoliatus  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Rosaceae | Rosa foetida | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus limonia  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Solanaceae | Capsicum annuum L.  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Verbenaceae | Duranta repens | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Bangia fuscopurpurea | Ref. |
| - | - | Bonnemaisonia hamifera | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Gallus gallus domesticus  | Ref. |
| - | - | Gigartina stellata | Ref. |
| - | - | Nemalion helminthoides | Ref. |
| - | - | Phodymenia palmata | Ref. |
| - | - | Staria italia | Ref. |
|
|
zoom in
| Organism | Citrus limon | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., Journal of Natural Products, 66, (2003), 1002 |
|---|
|