| Name |
4-Vinylphenol p-Hydroxystyrene |
| Formula |
C8H8O |
| Mw |
120.05751488 |
| CAS RN |
2628-17-3 |
| C_ID |
C00050421
|
| InChIKey |
FUGYGGDSWSUORM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
| SMILES |
C=Cc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Salicaceae | Salix capitata | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Taxus baccata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|