| Name |
2-n-Nonylquinolin-4(1H)-one 2-Nonylquinolin-4(1H)-one |
| Formula |
C18H25NO |
| Mw |
271.19361443 |
| CAS RN |
55396-45-7 |
| C_ID |
C00048277
, 
|
| InChIKey |
KKRXDNYRUZGPFM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H25NO/c1-2-3-4-5-6-7-8-11-15-14-18(20)16-12-9-10-13-17(16)19-15/h9-10,12-14H,2-8,11H2,1H3,(H,19,20) |
| SMILES |
CCCCCCCCCc1cc(=O)c2ccccc2[nH]1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Boronia bowmanii | Ref. |
| Plantae | Rutaceae | Euodia rutacarpa | Ref. |
| Plantae | Rutaceae | Euodia sutchuenensis | Ref. |
| Plantae | Rutaceae | Haplophyllum acutifolium  | Ref. |
| Plantae | Rutaceae | Raulinoa echinata | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| - | - | Pseudomonas(strain 1531-E7-associated with sponge Homophymia sp.) | Ref. |
|
|
zoom in
| Organism | Pseudomonas(strain 1531-E7-associated with sponge Homophymia sp.) | | Reference | Natural Products Vol.1 ISBN978-3-642-22143-9 |
|---|
|