| Name |
trans-Calamenene |
| Formula |
C15H22 |
| Mw |
202.1721507 |
| CAS RN |
73209-42-4 |
| C_ID |
C00037928
, 
|
| InChIKey |
PGTJIOWQJWHTJJ-QWAQRTLVNA-N |
| InChICode |
InChI=1S/C15H22/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5,7,9-10,12-13H,6,8H2,1-4H3/t12-,13+/m1/s1 |
| SMILES |
Cc1ccc2c(c1)[C@H](C(C)C)CC[C@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis nootkatensis  | Ref. |
| Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|