| Name |
Isomenthone |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
491-07-6 |
| C_ID |
C00037333
, 
|
| InChIKey |
NFLGAXVYCFJBMK-MDWBIBFBNA-N |
| InChICode |
InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9-/m0/s1 |
| SMILES |
CC(C)[C@@H]1CC[C@H](C)CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Asteraceae | Echinops grijsii | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mentha haplocalyx  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Satureja douglasii | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Plagiochilaceae | Plagiochila rutilans | Ref. |
|
|
zoom in
| Organism | Mentha haplocalyx | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|