| Name |
N-trans-Feruloyl tyramine |
| Formula |
C18H19NO4 |
| Mw |
313.1314081 |
| CAS RN |
666-48-43-9 |
| C_ID |
C00035142
, 
|
| InChIKey |
NPNNKDMSXVRADT-WEVVVXLNSA-N |
| InChICode |
InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+ |
| SMILES |
COc1cc(/C=C/C(=O)NCCc2ccc(O)cc2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Polyalthia suberosa | Ref. |
| Plantae | Chenopodiaceae | Chenopodium album  | Ref. |
| Plantae | Convallariaceae | Disporopsis aspera | Ref. |
| Plantae | Fumariaceae | Hypecoum sp. | Ref. |
| Plantae | Malvaceae | Hibiscus cannabinus  | Ref. |
| Plantae | Menispermaceae | Tinospora cordifolia  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus niger | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|