| Name |
(-)-Balanophonin Balanophonin |
| Formula |
C20H20O6 |
| Mw |
356.12598837 |
| CAS RN |
80286-36-8 |
| C_ID |
C00033656
, 
|
| InChIKey |
GWCSSLSMGCFIFR-XBNIMOMUNA-N |
| InChICode |
InChI=1S/C20H20O6/c1-24-17-10-13(5-6-16(17)23)19-15(11-22)14-8-12(4-3-7-21)9-18(25-2)20(14)26-19/h3-10,15,19,22-23H,11H2,1-2H3/b4-3+/t15-,19+/m1/s1 |
| SMILES |
COc1cc([C@@H]2Oc3c(OC)cc(/C=C/C=O)cc3[C@H]2CO)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Amentotaxus yunnanensis | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia L  | Ref. |
| Plantae | Rubiaceae | Tarenna attenuata | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus niger | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|