| Name |
Picroside I |
| Formula |
C24H28O11 |
| Mw |
492.16316174 |
| CAS RN |
27409-30-9 |
| C_ID |
C00031028
, 
|
| InChIKey |
XZGPUOQGERGURE-OCAHRNEWNA-N |
| InChICode |
InChI=1S/C24H28O11/c25-11-24-16-13(17(27)21(24)35-24)8-9-31-22(16)34-23-20(30)19(29)18(28)14(33-23)10-32-15(26)7-6-12-4-2-1-3-5-12/h1-9,13-14,16-23,25,27-30H,10-11H2/b7-6+/t13-,14+,16+,17-,18+,19-,20+,21-,22-,23-,24+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccccc1)OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@H]3[C@H](O)[C@@H]4O[C@]4(CO)[C@@H]23)[C@H](O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Neopicrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurroa  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurrooa | Ref. |
| Plantae | Plantaginaceae | Picrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Wulfenia baldaccii Degen | Ref. |
| Plantae | Plantaginaceae | Wulfenia blechicii Lakusic subsp. | Ref. |
| - | - | Picrorrhiza kurrooa | Ref. |
| - | - | Picrorrhiza scrophulariflora | Ref. |
|
|
zoom in
| Organism | Picrorrhiza kurrooa | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|