| Name |
Isoplatydesmine (+)-Isoplatydesmine 6-Deoxyribaline |
| Formula |
C15H17NO3 |
| Mw |
259.12084342 |
| CAS RN |
27495-37-0 |
| C_ID |
C00026352
, 
|
| InChIKey |
VLHROMVHVKMNLA-STGVRZAANA-N |
| InChICode |
InChI=1S/C15H17NO3/c1-15(2,18)12-8-10-13(17)9-6-4-5-7-11(9)16(3)14(10)19-12/h4-7,12,18H,8H2,1-3H3/t12-/m1/s1 |
| SMILES |
Cn1c2c(c(=O)c3ccccc31)C[C@H](C(C)(C)O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate L-His |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pelliaceae | Pellia barbigera | Ref. |
| Plantae | Rutaceae | Araliopsis soyauxii | Ref. |
| Plantae | Rutaceae | Araliopsis tabouensis | Ref. |
| Plantae | Rutaceae | Boronella pancheri | Ref. |
| Plantae | Rutaceae | Citrus macroptera  | Ref. |
| Plantae | Rutaceae | Euodia gracilis | Ref. |
| Plantae | Rutaceae | Evodia lepta  | Ref. |
| Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
| Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
| Plantae | Rutaceae | Orixa japonica  | Ref. |
| Plantae | Rutaceae | Pelea barbigera | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Rutaceae | Teclea nobilis  | Ref. |
| Plantae | Rutaceae | Teclea simplicifolia  | Ref. |
| Plantae | Rutaceae | Zanthoxylum nitidum  | Ref. |
|
|
zoom in
| Organism | Evodia lepta | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|