| Name |
3alpha-Phenylacetoxytropane |
| Formula |
C16H21NO2 |
| Mw |
259.15722892 |
| CAS RN |
1690-22-8 |
| C_ID |
C00025555
, 
|
| InChIKey |
DCINQANYMBYYCH-FICVDOATNA-N |
| InChICode |
InChI=1S/C16H21NO2/c1-17-13-7-8-14(17)11-15(10-13)19-16(18)9-12-5-3-2-4-6-12/h2-6,13-15H,7-11H2,1H3/t13-,14+,15+ |
| SMILES |
CN1[C@@H]2CC[C@H]1C[C@@H](OC(=O)Cc1ccccc1)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum dekindtii (Engl.)O.E.Schultz | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum hypericifolium Lam.  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum pervillei | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Atropa belladonna L.  | Ref. |
| Plantae | Solanaceae | Datura candida X candida  | Ref. |
| Plantae | Solanaceae | Datura stramonium  | Ref. |
|
|
zoom in
| Organism | Datura stramonium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|