| Name |
gamma-Himachalene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
53111-25-4 |
| C_ID |
C00021310
, 
|
| InChIKey |
PUWNTRHCKNHSAT-ZCWZLOQUNA-N |
| InChICode |
InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h6,10,13-14H,5,7-9H2,1-4H3/t13-,14+/m0/s1 |
| SMILES |
CC1=C[C@H]2[C@@H](CC1)C(C)=CCCC2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Pterocaulon virgatum | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
| Plantae | Myrtaceae | Psidium guajava | Ref. |
| Plantae | Pinaceae | Cedrus libani | Ref. |
| Plantae | Primulaceae | Primula halleri | Ref. |
|
|
zoom in
| Organism | Primula halleri |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
