| Name |
Euscaphic acid Euscophic acid Jacarandic acid 2alpha,3alpha,19alpha-Trihydroxyurs-12-en-28-oic acid |
| Formula |
C30H48O5 |
| Mw |
488.35017464 |
| CAS RN |
53155-25-2 |
| C_ID |
C00019491
, 
|
| InChIKey |
OXVUXGFZHDKYLS-SGCGZWIHNA-N |
| InChICode |
InChI=1S/C30H48O5/c1-17-10-13-30(24(33)34)15-14-27(5)18(22(30)29(17,7)35)8-9-21-26(4)16-19(31)23(32)25(2,3)20(26)11-12-28(21,27)6/h8,17,19-23,31-32,35H,9-16H2,1-7H3,(H,33,34)/t17-,19-,20+,21-,22-,23-,26+,27-,28-,29-,30+/m1/s1 |
| SMILES |
C[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2[C@]1(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Jacaranda caucana | Ref. |
| Plantae | Cecropiaceae | Musanga cecropioides  | Ref. |
| Plantae | Cecropiaceae | Myrianthus arboreus  | Ref. |
| Plantae | Labiatae | Salvia trijuga | Ref. |
| Plantae | Lamiaceae | Coleus amboinicus  | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis KOEHNE  | Ref. |
| Plantae | Rosaceae | Cotoneaster simonsii | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rosaceae | Rubus ellipticus var.obcordatus  | Ref. |
| Plantae | Rosaceae | Sanguisorba officinalis  | Ref. |
| Plantae | Staphyleaceae | Euscaphis japonica | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
| - | - | Eribotrya japonica | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|