| Name |
(-)-Homopterocarpin Baphinitone 3,9-Dimethoxypterocarpan |
| Formula |
C17H16O4 |
| Mw |
284.104859 |
| CAS RN |
606-91-7 |
| C_ID |
C00009613
, 
|
| InChIKey |
VPGIGLKLCFOWDN-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O4/c1-18-10-4-6-13-15(7-10)20-9-14-12-5-3-11(19-2)8-16(12)21-17(13)14/h3-8,14,17H,9H2,1-2H3/t14-,17-/m1/s1 |
| SMILES |
COc1ccc2c(c1)OC1c3ccc(OC)cc3OCC21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Ononis viscosa subsp. breviflora  | Ref. |
| Plantae | Fabaceae | Pericopsis angolensis  | Ref. |
| Plantae | Fabaceae | Pericopsis schliebenii | Ref. |
| Plantae | Fabaceae | Pterocarpus indicus  | Ref. |
| Plantae | Fabaceae | Pterocarpus spp. | Ref. |
| Plantae | Fabaceae | Swartzia madagascariensis  | Ref. |
| Plantae | Fabaceae | Trifolium hybridum  | Ref. |
|
|
zoom in
| Organism | Pterocarpus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Cazeneuve,C.R.Acad.Sci.Paris,104,(1887),1722
Raudnitz,Ber.Dtsch.Chem.Ges.,68B,(1935),1862 |
|---|
|