| Name |
Fisetinidol |
| Formula |
C15H14O5 |
| Mw |
274.08412356 |
| CAS RN |
490-49-3 |
| C_ID |
C00008822
, 
|
| InChIKey |
VFZYLYJWCROVLO-UYWMCZCJNA-N |
| InChICode |
InChI=1S/C15H14O5/c16-10-3-1-8-5-13(19)15(20-14(8)7-10)9-2-4-11(17)12(18)6-9/h1-4,6-7,13,15-19H,5H2/t13-,15+/m0/s1 |
| SMILES |
Oc1ccc2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Fabaceae | Acacia mearnsii  | Ref. |
| Plantae | Fabaceae | Acacia spp.  | Ref. |
| Plantae | Fabaceae | Colophospermum mopane  | Ref. |
| Plantae | Fabaceae | Peltophorum africanum  | Ref. |
| Plantae | Myristicaceae | Virola elongata | Ref. |
| Plantae | Myristicaceae | Virola minutifolia | Ref. |
|
|
zoom in
| Organism | Virola minutifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Freudenberg,Ann.,10,(1934),913
Roux,Biochem.J.,78,(1961),120 |
|---|
|