| Name |
Dihydrokaempferol-3-O-alpha-L-rhamnopyranoside Engeletin |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
572-31-6 |
| C_ID |
C00008672
, 
|
| InChIKey |
VQUPQWGKORWZII-SEDJNUSINA-N |
| InChICode |
InChI=1S/C21H22O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-25,27-28H,1H3/t8-,15-,17+,18-,19-,20-,21-/m0/s1 |
| SMILES |
CC1O[C@@H](O[C@H]2C(=O)c3c(O)cc(O)cc3O[C@@H]2c2ccc(O)cc2)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cunoniaceae | Eucryphia cordifolia | Ref. |
| Plantae | Fabaceae | Andira inermis  | Ref. |
| Plantae | Juglandaceae | Engelhardtia formosana | Ref. |
| Plantae | Moraceae | Artocarpus dadah  | Ref. |
| Plantae | Myrtaceae | Eucalyptus flocktoniae | Ref. |
| Plantae | Myrtaceae | Eucalyptus sideroxylon | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus procera | Ref. |
| Plantae | Rutaceae | Flindersia australis | Ref. |
| Plantae | Smilacaceae | Smilax bockii | Ref. |
| Plantae | Smilacaceae | Smilax china  | Ref. |
| Plantae | Smilacaceae | Smilax glabra  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Nothofagus procera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 798,Flavanones and dihydroflavonols
Tominaga,J.Pharm.Soc.Jpn,75,(1955),1399
Janes,J.Chem.Soc.,(1960),2560 |
|---|
|