| Name |
(2S)-Pinocembrin (-)-(2S)-Pinocembrin Pinostrobin (-)-Pinostrobin |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
480-37-5 |
| C_ID |
C00008144
, 
|
| InChIKey |
ORJDDOBAOGKRJV-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-8,14,17H,9H2,1H3/t14-/m1/s1 |
| SMILES |
COc1cc(O)c2c(c1)OC(c1ccccc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Uvaria chamae  | Ref. |
| Plantae | Asteraceae | Helichrysum sp. | Ref. |
| Plantae | Asteraceae | Heterothalamus psiadioides | Ref. |
| Plantae | Betulaceae | Alnus sp. | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Lauraceae | Aniba sp. | Ref. |
| Plantae | Lauraceae | Litsea glaucescens | Ref. |
| Plantae | Pinaceae | Larix sp. | Ref. |
| Plantae | Pinaceae | Pinus sp.  | Ref. |
| Plantae | Pinaceae | Pinus strobus | Ref. |
| Plantae | Polygonaceae | Polygonum ferrugineum  | Ref. |
| Plantae | Polygonaceae | Polygonum lapathifolium  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Prunus sp.  | Ref. |
| Plantae | Salicaceae | Populus sp. | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF.  | Ref. |
|
|
zoom in
| Organism | Scutellaria spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 238,Flavanones and dihydroflavonols
Lindstedt,Acta Chem.Scand.,5,(1951),129
Wollenweber,Phytochem.,10,(1971),225 |
|---|
|