| Name |
Asebotin |
| Formula |
C22H26O10 |
| Mw |
450.15259705 |
| CAS RN |
11075-15-3 |
| C_ID |
C00007992
, 
|
| InChIKey |
PQCIBORQLVRFMR-OXFOAJKANA-N |
| InChICode |
InChI=1S/C22H26O10/c1-30-13-8-15(26)18(14(25)7-4-11-2-5-12(24)6-3-11)16(9-13)31-22-21(29)20(28)19(27)17(10-23)32-22/h2-3,5-6,8-9,17,19-24,26-29H,4,7,10H2,1H3/t17-,19+,20-,21+,22+/m0/s1 |
| SMILES |
COc1cc(O)c(C(=O)CCc2ccc(O)cc2)c(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Andromeda japonica | Ref. |
| Plantae | Ericaceae | Kalmia angustifolia  | Ref. |
| Plantae | Ericaceae | Kalmia latifolia  | Ref. |
| Plantae | Ericaceae | Loiseleuria procumbens (L.) Desv. | Ref. |
| Plantae | Ericaceae | Lyonia formosa | Ref. |
| Plantae | Ericaceae | Pieris japonica  | Ref. |
| Plantae | Ericaceae | Pieris taiwanensis | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
|
|
zoom in
| Organism | Pieris taiwanensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Eykman,Rec.Trav.Chim.,2,(1883),99
Williams,Nature,202,(1964),824 |
|---|
|