| Name |
2',6'-Dihydroxy-4'-methoxydihydrochalcone |
| Formula |
C16H16O4 |
| Mw |
272.104859 |
| CAS RN |
35241-55-5 |
| C_ID |
C00007929
, 
|
| InChIKey |
MDMCODCJMHTFIZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H16O4/c1-20-12-9-14(18)16(15(19)10-12)13(17)8-7-11-5-3-2-4-6-11/h2-6,9-10,18-19H,7-8H2,1H3 |
| SMILES |
COc1cc(O)c(C(=O)CCc2ccccc2)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Mitrella kentii | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Lauraceae | Cryptocarya idenburgensis | Ref. |
| Plantae | Lauraceae | Lindera umbellata  | Ref. |
| Plantae | Lauraceae | Litsea glaucescens | Ref. |
| Plantae | Phrymaceae | Mimulus aurantiacus | Ref. |
| Plantae | Piperaceae | Piper aduncum  | Ref. |
| Plantae | Piperaceae | Piper hostmannianum var.berbicense | Ref. |
| Plantae | Pteridaceae | Adiantum sulphureum | Ref. |
| Plantae | Pteridaceae | Notholaena spp. | Ref. |
| Plantae | Pteridaceae | Pityrogramma spp. | Ref. |
| Plantae | Salicaceae | Populus angustifolia | Ref. |
| Plantae | Salicaceae | Populus balsamifera  | Ref. |
| Plantae | Salicaceae | Populus deltoides | Ref. |
| Plantae | Salicaceae | Populus nigra  | Ref. |
|
|
zoom in
| Organism | Piper aduncum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Goris,Compt.Rend.,201,(1935),1435
Nilsson,Acta Chem.Scand.,15,(1961),154 |
|---|
|